7-Fluoronaphthalen-2-ol is a fluorinated naphthol derivative used as a research reagent. Its structure features a naphthalene ring system with a hydroxyl group and a fluorine substituent, contributing to its properties for laboratory studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 889884-94-0
2-(1-(benzyloxycarbonyl)pyrrolidin-2-yl)acetic acid
research reagent
2,3-Pyrazinedicarboxylic acid
research compound
1,4-Dimethoxy-2-nitrobenzene
research compound
5-Methylsalicylic acid
Research compound
7-fluoronaphthalen-2-ol
JCBBZMAQEXJMCY-UHFFFAOYSA-N
C1=CC(=CC2=C1C=CC(=C2)F)O