This compound is an indole-containing acetic acid derivative used primarily as a research reagent. It features a biphenyl structure linked to an indole ring, giving it a relatively high molecular weight and moderate lipophilicity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 886363-20-8
2-(4-(1h-indol-5-yl)phenyl)acetic acid
pharmaceutical intermediate
5-Bromo-4-methylpyridine-2-carbonitrile
research reagent
5-Bromo-4-methylpyridine-2-carboxylic acid
research compound
2-BROMO-4-(PYRIDIN-2-YL)THIAZOLE
Research compound
3-Bromo-6-chloroimidazo[1,2-a]pyridine
Research compound
3-(1H-indol-5-yl)benzoic Acid
Research compound
2-(2-(1h-indol-5-yl)phenyl)acetic acid
research compound
4-(1H-indol-5-yl)benzoic Acid
research compound
2-[3-(1H-indol-5-yl)phenyl]acetic acid
UTQLDLXUWNVRHF-UHFFFAOYSA-N
C1=CC(=CC(=C1)C2=CC3=C(C=C2)NC=C3)CC(=O)O
—