2-(1H-indol-5-yl)benzoic acid is an indole-containing aromatic carboxylic acid used as a research compound. It features both a benzoic acid moiety and an indole ring system, contributing to its structural properties for laboratory investigations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 886363-17-3
5-Bromo-4-methylpyridine-2-carbonitrile
research reagent
5-Bromo-4-methylpyridine-2-carboxylic acid
research compound
2-(2-(1h-indol-5-yl)phenyl)acetic acid
research compound
3-(1H-indol-5-yl)benzoic Acid
Research compound
4-(1H-indol-5-yl)benzoic Acid
research compound
2-(4-(1h-indol-5-yl)phenyl)acetic acid
pharmaceutical intermediate
2-(1H-indol-5-yl)benzoic acid
PKGXRKSYWVXMKT-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=CC3=C(C=C2)NC=C3)C(=O)O