This compound is a pharmaceutical intermediate featuring a piperidine ring, a carboxylic acid group, and protective groups. It is typically used in the synthesis of more complex pharmaceutical agents.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 886362-33-0
3-N-Fmoc-amino-3-(3'-Cbz)piperidine-propionic acid
Pharmaceutical intermediate for peptide synthesis
Tert-butyl 4-(3-bromophenyl)piperidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
4,5-difluoro-2-methylindole-3-carboxylic acid ethyl ester
Pharmaceutical intermediate
Ethyl 5-fluoro-2-methyl-1h-indole-3-carboxylate
pharmaceutical intermediate
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-phenylmethoxycarbonylpiperidin-4-yl)propanoic acid
UBHLDUJTRRPSSS-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC(CC(=O)O)C1CCN(CC1)C(=O)OCC2=CC=CC=C2
—