4,6-Dichloro-2-methyl-1H-indole is a halogenated indole derivative used primarily as a research compound. It is structurally related to the tetrahydropyridinylindole (THPI) family and has been investigated for its activity at serotonin 5-HT2 receptors.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 886362-21-6
3-((tert-Butoxycarbonyl)amino)-3-(piperidin-2-yl)propanoic acid
research compound for peptide synthesis
3-(1-((Benzyloxy)carbonyl)piperidin-2-yl)-3-((tert-butoxycarbonyl)amino)propanoic acid
research compound
4-Fluoro-2-methylindole-3-carboxylic acid ethyl ester
chemical research intermediate
Ethyl 6-fluoro-2-methyl-1h-indole-3-carboxylate
research compound
4,6-dichloro-2-methyl-1H-indole
UCUSJGONHVYQIE-UHFFFAOYSA-N
CC1=CC2=C(N1)C=C(C=C2Cl)Cl