This compound is a pharmaceutical intermediate, specifically a tert-butyl carbamate derivative of a cyclohexanone. It is primarily used as a building block in the synthesis of more complex organic molecules for pharmaceutical research and development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 885280-38-6
(S)-GNA-C(Bz)-phosphoramidite
Pharmaceutical intermediate for oligonucleotide synthesis
(R)-3-(7-Cyano-5-(2-((2-(2-(2,2,2-trifluoroethoxy)phenoxy)ethyl)amino)propyl)indolin-1-yl)propyl benzoate oxalate
Pharmaceutical intermediate for silodosin analog
((4-(4-Fluorophenyl)-6-isopropyl-2-(N-methylmethylsulfonamido)pyrimidin-5-yl)methyl)triphenylphosphonium bromide
Rosuvastatin intermediate
Methyl 6-bromo-1H-indazole-4-carboxylate
Pharmaceutical intermediate
Tert-butyl N-(4-oxocyclohexyl)carbamate
pharmaceutical intermediate
4-tert-Butylcyclohexanone
chemical intermediate for agrochemicals and fragrances
2-Chlorocyclohexanone
pharmaceutical intermediate
2-ACETYLCYCLOHEXANONE
Organic synthesis intermediate
tert-butyl N-(3-oxocyclohexyl)carbamate
VGDCXKATFLOEHF-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1CCCC(=O)C1