2-Chloro-3-nitropyrazine is a research compound with a heterocyclic aromatic structure. It is characterized by the presence of a chlorine atom and a nitro group attached to a pyrazine ring, making it a reagent of interest in organic synthesis and pharmaceutical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 87885-43-6
Pentafluorophenylmagnesium bromide
Grignard reagent for organic synthesis
(2R,3R,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)tetrahydro-2H-pyran-3,4-diyl diacetate
chemical probe for glycobiology
((2R,3S,4R,5R,6S)-4-(Benzyloxy)-5-(((benzyloxy)carbonyl)amino)-3-hydroxy-6-methoxytetrahydro-2H-pyran-2-yl)methyl benzoate
protected sugar building block
2-(2-chloro-5-nitrophenyl)pyridine
research compound
2-chloro-3-nitropyrazine
WFJAKBGXNXBMLL-UHFFFAOYSA-N
C1=CN=C(C(=N1)[N+](=O)[O-])Cl