This compound is a chiral alcohol used as a research reagent. It features a stereocenter and contains an aromatic ring substituted with chlorine and fluorine atoms, contributing to its specific molecular properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 877397-65-4
Tert-butyl 4-(4-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate
Research compound for synthesis
Tetrabutylammonium fluoride trihydrate
Phase transfer catalyst and fluorination reagent
H2-Gamendazole
research compound
KG 5
research compound
(alphaR)-2,6-Dichloro-3-fluoro-alpha-methylbenzenemethanol
pharmaceutical intermediate
(1S)-1-(2,6-dichloro-3-fluorophenyl)ethanol
JAOYKRSASYNDGH-BYPYZUCNSA-N
C[C@@H](C1=C(C=CC(=C1Cl)F)Cl)O