This compound is a protected cysteine derivative used as a building block in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino group and a trityl (Trt) protecting group on the thiol side chain, enabling selective deprotection during solid-phase or solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 87494-13-1
2,6-Dichloro-4-methylnicotinonitrile
Pharmaceutical intermediate
D-PHENYLGLYCINE
Pharmaceutical intermediate for peptide synthesis
(3-Formyl-4-(2-iodo-benzyloxy)-phenyl)-acetic acid methyl ester
Pharmaceutical intermediate
Fmoc-L-Ala-L-Ala-OH
Peptide synthesis intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid
JDTOWOURWBDELG-HSZRJFAPSA-N
CC(C)(C)OC(=O)N[C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O