m-PEG7-acid is a monodisperse polyethylene glycol (PEG) derivative containing a terminal carboxylic acid group. It is primarily used as a research reagent for PEGylation, a process that modifies biomolecules or surfaces to improve solubility and stability.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 874208-91-0
(2-Cyanopyridin-3-yl)boronic acid
research compound for boronic acid chemistry
3-p-Anisoyl Acacetin
Impurity reference standard for acacetin
(S)-benzyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
L-Phenylalanine, (alphaS)-alpha-[[2-(4-morpholinyl)acetyl]amino]benzenebutanoyl-L-leucyl-, phenylmethyl ester
research compound
3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
NOPQIPMESCUIHH-UHFFFAOYSA-N
COCCOCCOCCOCCOCCOCCOCCC(=O)O