1,5-This compound is a chemical compound used as a research reagent. It is characterized by the presence of ester and halogen functional groups, contributing to its reactivity in organic synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 870-78-0
Ethyl 2-bromobutyrate
n.a
1,6-diethyl 2,5-dibromohexanedioate
research compound
2-chloro-3-fluoro-5-hydroxypyridine
research compound
Methyl 3-(5-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
4-Cyano-4-(dodecylsulfanylthiocarbonyl)sulfanylpentanoic acid
RAFT polymerization chain transfer agent
2-Cyano-2-propyl dodecyl trithiocarbonate
RAFT polymerization chain transfer agent
diethyl 2,4-dibromopentanedioate
DUSLEJGELFKEAS-UHFFFAOYSA-N
CCOC(=O)C(CC(C(=O)OCC)Br)Br
—