S-Methylisothiourea hemisulfate is a chemical compound consisting of two methyl carbamimidothioate units and one sulfuric acid molecule. It is primarily used as a pharmaceutical intermediate in the synthesis of other compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 867-44-7
2-Methylisothiouronium chloride
research compound
2-benzyl-2,8-diazaspiro[4.5]decane
pharmaceutical intermediate
4-CHLORO-5-METHOXYPYRIDIN-2-AMINE
pharmaceutical intermediate
Ethyl (3S)-4-chloro-3-hydroxybutanoate
pharmaceutical intermediate
(3S,8R,9S,10R,13S,14S)-17,17-diiodo-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol
Abiraterone impurity reference standard
methyl carbamimidothioate;sulfuric acid
BZZXQZOBAUXLHZ-UHFFFAOYSA-N
CSC(=N)N.CSC(=N)N.OS(=O)(=O)O