Fmoc-Val-Cit-PAB-PNP is a research reagent used as a peptide conjugation reagent in laboratory settings. It features a complex molecular structure with multiple amide and ether groups, along with aromatic rings, making it suitable for specialized conjugation applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 863971-53-3
(9H-Fluoren-9-yl)methyl ((6S,9S)-1-amino-9-isopropyl-6-((4-((((4-nitrophenoxy)carbonyl)oxy)methyl)phenyl)carbamoyl)-1,8,11,14,17-pentaoxo-2,7,10,13,16-pentaazaoctadecan-18-yl)carbamate
research compound
Boc-Val-Cit-PAB-PNP
Antibody-drug conjugate linker reagent
Bz-Nle-Lys-Arg-Arg-AMC
fluorogenic substrate for proteases
Hexanedioic Acid Mono-(2-carboxyphenyl) Ester
reference standard for impurity analysis
(4-(5-bromo-2-chlorobenzyl)phenoxy)(tert-butyl)dimethylsilane
research compound
3-(9H-Carbazol-9-yl)phenylboronic acid
research compound for organic synthesis
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate
USMYACISHVPTHK-PXLJZGITSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35