This compound is a research compound with an aromatic and polar structure, containing amine, ether, and hydroxyl functional groups. It is supplied as a laboratory reagent for chemical and pharmaceutical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 861841-90-9
(S)-(+)-4-Phenyl-2-oxazolidinone
chiral auxiliary for asymmetric synthesis
1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
research compound
Cyclo(RGDfC)
research reagent
(3-Morpholinophenyl)boronic acid hydrochloride
research compound
1-(3-amino-2-hydroxy-5-phenylmethoxyphenyl)ethanone
VHNDAASEYRABBJ-UHFFFAOYSA-N
CC(=O)C1=C(C(=CC(=C1)OCC2=CC=CC=C2)N)O