This compound is a research linker reagent featuring a complex polycyclic core with multiple ether and ester functionalities, including a succinate ester group and a trityl-type protecting group. Its significance lies in its use as a building block in chemical synthesis and pharmaceutical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 852684-08-3
Phosphonic acid, p-((4-((4-hydroxy-3-(1-methylethyl)phenyl)methyl)-3,5-dimethylphenoxy)methyl)-
certified reference standard impurity
Ru(bpm)3(PF6)2
photoredox catalyst
3',5'-TIPS-N-Ac-Cytidine
protected nucleoside research compound
9-(4-bromophenyl)phenanthrene
research compound
4-[[(3aS,4S,5S,6R,7R,7aR)-6-[bis(4-methoxyphenyl)-phenylmethoxy]-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl]oxy]-4-oxobutanoic acid
KPROLRFVRRGFBD-RHEFJYAGSA-N
COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)O[C@@H]4[C@H]5[C@H]6[C@@H]([C@@H]([C@@H]4OC(=O)CCC(=O)O)O5)C(=O)N(C6=O)C7=CC=CC=C7