This compound is a salt-like organophosphorus compound used as a nucleating agent in plastic materials. It is typically incorporated into polymers at a concentration around 0.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 85209-91-2
ADK Stab NA 21E
plastic additive and stabilizer
4'-(TRANS-4-PROPYLCYCLOHEXYL)-3,4-DIFLUOROBIPHENYL
liquid crystal intermediate
1,2,3,4-Butanetetracarboxylic acid, tetramethyl ester, reaction products with 1,2,2,6,6-pentamethyl-4-piperidinol and .beta.,.beta.,.beta.',.beta.'-tetramethyl-2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diethanol
plastic additive
Trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
Coating composition for glass and textiles
1-butoxyethyl methacrylate
methacrylate monomer for polymer synthesis
sodium 1,3,7,9-tetratert-butyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide
ZHROMWXOTYBIMF-UHFFFAOYSA-M
CC(C)(C)C1=CC2=C(C(=C1)C(C)(C)C)OP(=O)(OC3=C(C2)C=C(C=C3C(C)(C)C)C(C)(C)C)[O-].[Na+]