Lidocaine D10 is a deuterium-labeled version of lidocaine, where ten hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in mass spectrometry and analytical chemistry for the quantification of lidocaine.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 851528-09-1
5-chloro-2-methoxy-4-methylnicotinic acid
research compound
3-(3-Chloropropyl)-1,3-dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one
research compound
(S)-Ethyl 2-phenyl-2-((S)-piperidin-2-yl)acetate hydrochloride
Research reference standard
2-(3-HYDROXY-1-PHENYLPROPYL)-4-METHYLPHENOL
organic synthesis research chemical
Lidokain
local anesthetic and antiarrhythmic agent
Lidocaine hydrochloride monohydrate
active pharmaceutical ingredient
Lidocaine hydrochloride
local anesthetic active pharmaceutical ingredient
N-(2,6-dimethylphenyl)-2-[1,1,2,2,2-pentadeuterioethyl(2,2,2-trideuterioethyl)amino]acetamide
NNJVILVZKWQKPM-IXKWUQSXSA-N
[2H]C([2H])([2H])CN(CC(=O)NC1=C(C=CC=C1C)C)C([2H])([2H])C([2H])([2H])[2H]