N-Butyraldehyde-d8 is a deuterated form of butyraldehyde where all eight hydrogen atoms are replaced with deuterium. It is primarily used as a deuterated research standard in analytical chemistry, serving as a stable isotope-labeled internal standard for mass spectrometry and nuclear magnetic resonance spectroscopy.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 84965-36-6
25-Hydroxy Cholesterol-d6
Deuterated research standard
Dimethyl phthalate-3,4,5,6-d4
Deuterated research standard
2,2,3,3,3-pentadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)propan-1-one
Deuterated research standard
1,10-DECANE-D20-DIOL
Deuterated research standard
6-Methoxy-8-nitroquinoline
research compound
(Cyclopent-1-en-1-yl)boronic acid
Boronic acid building block
Lithium iodide (LiI), trihydrate
Laboratory reagent
(2S)-3-(dimethylamino)-1-(3-methoxyphenyl)-2-methyl-1-propanone
Research compound
1,2,2,3,3,4,4,4-octadeuteriobutan-1-one
ZTQSAGDEMFDKMZ-RIZALVEQSA-N
[2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]