1-{[(benzyloxy)carbonyl]amino}cyclopropane-1-carboxylic acid is a chemical compound used as a pharmaceutical intermediate, specifically in peptide synthesis. It features a cyclopropane ring with both carboxylic acid and protected amino functional groups, making it suitable for building specialized peptide structures.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 84677-06-5
1-(((Phenylmethoxy)carbonyl)amino)cyclopentanecarboxylic acid
research compound
5-Methyl-2'-o,4'-C-methylenecytidine
nucleoside analogue intermediate
(S)-tert-Butyl (1-(4-bromophenyl)ethyl)carbamate
Pharmaceutical intermediate for synthesis
1-Methyl-1H-pyrazole-4-boronic acid
Pharmaceutical intermediate for synthesis
1-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Pharmaceutical intermediate for synthesis
Benzyl (1-(hydroxymethyl)cyclopropyl)carbamate
peptide synthesis protecting reagent
1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid
KHINKCGJKZSHAJ-UHFFFAOYSA-N
C1CC1(C(=O)O)NC(=O)OCC2=CC=CC=C2