Ac-Glu(OtBu)-OH is an N-acetylated, side-chain-protected derivative of glutamic acid used as a building block in solid-phase peptide synthesis. Its structure includes a tert-butyl ester protecting group on the side chain carboxyl, enabling selective deprotection during chain assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 84192-88-1
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
1-(5-Bromoquinoxalin-6-yl)thiourea
research compound for biochemical studies
2-Amino-4-bromopyridine
research compound
4'-Benzyloxyphenyl acetylene
Research compound for organic synthesis
([1,2,4]Triazolo[4,3-b]pyridazin-6-yloxy)acetic acid
certified reference standard
(2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
FALCCLKESWGSNI-QMMMGPOBSA-N
CC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)O