This compound is an Fmoc-protected amino acid derivative featuring a phthalimide-protected lysine side chain. It is primarily used as a building block in solid-phase peptide synthesis, enabling the selective incorporation of modified lysine residues.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 83999-93-3
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(6-methoxypyridin-3-yl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-methoxy-2-methylphenyl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyldec-9-enoic acid
Fmoc-protected amino acid building block
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanoic acid
Fmoc-protected amino acid building block
2,3-Dichloro-5,6-dicyano-1,4-benzoquinone
Oxidizing agent in steroid synthesis
N-((9H-Fluoren-9-ylmethoxy)carbonyl)-N-methyl-L-alanine
Peptide synthesis building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-3-methylbutanoic acid
amino acid protecting reagent
Chitosan, 2-hydroxypropyl ether
pharmaceutical excipient raw material
(2S)-6-(1,3-dioxoisoindol-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
MDYADJADRHFGPE-VWLOTQADSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN4C(=O)C5=CC=CC=C5C4=O)C(=O)O