Hydroxy-alpha-sanshool is a fatty amide found in Sichuan pepper species, such as Zanthoxylum schinifolium, Zanthoxylum bungeanum, and Zanthoxylum piperitum. It is the compound primarily responsible for the characteristic pungent and tingling flavor associated with these peppers.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 83883-10-7
3-Hexanone, 5-mercapto-5-methyl-
Flavor and fragrance ingredient
Methyl 5-allyl-3-methoxysalicylate
flavor and fragrance ingredient
2,4,6-TRICHLOROANISOLE
off-flavor agent in wine corks
BETA-CARYOPHYLLENE
Fragrance and flavoring agent
(2E,6Z,8E,10E)-N-(2-hydroxy-2-methylpropyl)dodeca-2,6,8,10-tetraenamide
LHFKHAVGGJJQFF-UEOYEZOQSA-N
C/C=C/C=C/C=C\CC/C=C/C(=O)NCC(C)(C)O