Valiolamine is an unsaturated amino sugar and a C-7 aminocyclitol compound. It is recognized as a potent inhibitor of glycosidase enzymes, making it a valuable research reagent in glycobiology studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 83465-22-9
Indole-3-(4'-oxo)butyric acid
research compound
1,4-Dichlorobutane-d8
deuterated research compound
2-Aminomethyl-18-crown-6
synthetic intermediate for crown ether derivatives
Camphor Impurity 14
certified reference standard impurity
(1S,2S,3R,4S,5S)-5-amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol
VDLOJRUTNRJDJO-ZYNSJIGGSA-N
C1[C@@H]([C@@H]([C@H]([C@@H]([C@]1(CO)O)O)O)O)N