This compound is a chemical compound featuring an aromatic ring with two fluorine substituents and a carboxylate group. It is primarily used as an intermediate in the synthesis of various pharmaceutical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 83198-07-6
3,5-Dimethylisoxazole-4-boronic acid pinacol ester
pharmaceutical intermediate
2-(3-(Carboxymethyl)-4-(phenylthio)phenyl)propanoic acid
Zatoprofen intermediate anti-inflammatory
Ethyl 4-(((1R)-2-(5-(2-fluoro-3-methoxyphenyl)-3-(2-fluoro-6-(trifluoromethyl)benzyl)-4-methyl-2,6-dioxo-3,6-dihydro-1(2H)-pyrimidinyl)-1-phenylethyl)amino)butanoate
Elagolix intermediate
(1R,5S)-8-Benzyl-8-azabicyclo(3.2.1)octan-3-one hydrochloride
pharmaceutical intermediate
2,4-Difluorobenzoic Acid-d3
deuterated research compound
2,4-Difluorobenzoic acid
Pharmaceutical intermediate for synthesis
2,4-difluorobenzoate
NJYBIFYEWYWYAN-UHFFFAOYSA-M
C1=CC(=C(C=C1F)F)C(=O)[O-]