This compound is a deuterated derivative of fluorene in which all ten hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard in mass spectrometry to improve quantification accuracy.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 81103-79-9
Progesterone-2,2,4,6,6,17alpha,21,21,21-d9
deuterated internal standard for mass spectrometry
(R,R)-1,2-Bis[(2-methylphenyl)-(phenyl)phosphino]ethane
chiral ligand for asymmetric synthesis
Methyl N-(diphenylmethylidene)glycinate
research intermediate for amino acid derivatives
811794-35-1
organometallic research reagent
(9H-Fluoren-9-yl)methyl 3-aminopiperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
9H-Fluorene
production of resins and dyes
1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene
NIHNNTQXNPWCJQ-QNNBDYQESA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C(=C3C2([2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]