This compound is a protected glycosyl bromide, specifically a per-O-pivaloylated alpha-D-glucopyranosyl bromide. It is primarily used as a building block in the synthesis of oligosaccharides, where the pivaloyl groups serve as protecting groups and the bromide acts as a leaving group for glycosylation reactions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 81058-27-7
Methyl 4-amino-4-naphthalen-2-yl-butyrate hydrochloride
Pharmaceutical intermediate
3-Aminoethyl-1-N-Cbz-pyrrolidine
Pharmaceutical intermediate
Benzyl 2-(aminomethyl)piperidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
2,4-Difluorophenylacetic acid
Pharmaceutical intermediate for drug synthesis
[(2R,3R,4S,5R,6R)-6-bromo-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate
BSDBCYHGMPHOAL-SFFUCWETSA-N
CC(C)(C)C(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)Br)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C