This compound is a chlorinated naphthalenimine derivative used as a research reagent. Its structure features two aromatic rings and two halogen substituents, with a molecular weight and lipophilicity suitable for laboratory studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 79560-20-6
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
2-Amino-5-bromopyrazine
Research compound for chemical synthesis
2,5-Difluorophenylacetic acid
Research compound for chemical synthesis
2-Bromo-5-(trifluoromethyl)benzyl alcohol
Research compound for chemical synthesis
N-Acetyl-3-sulfo-L-alanine
impurity reference standard
Crassicauline A
toxic diterpene alkaloid plant metabolite
2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic Acid
research compound
2,5-Dibromo-3-(trifluoromethyl)pyridine
research compound
4-(3,4-dichlorophenyl)-N-methyl-3,4-dihydro-2H-naphthalen-1-imine
MGBVAZJASCWJGJ-UHFFFAOYSA-N
CN=C1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl