Dimethyl 2,3-difluorofumarate is a fluorinated organic compound used as a pharmaceutical intermediate. Its structure features two ester groups and two fluorine atoms attached to a carbon-carbon double bond.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 79322-43-3
(6R,7R)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Pharmaceutical intermediate for cephalosporin antibiotics
Methyl 4-(3-amino-3-methylbutyl)benzoate
pharmaceutical intermediate
Rel-(2R)-6-Fluoro-3,4-dihydro-2-((2S)-2-oxiranyl)-2H-1-benzopyran
Pharmaceutical intermediate
Cefixime EP Impurity F
Cefixime impurity reference standard
Dimethyl 2,3-difluoromaleate
specialty chemical intermediate
dimethyl (E)-2,3-difluorobut-2-enedioate
ZDGDBABNSVPXFK-ONEGZZNKSA-N
COC(=O)/C(=C(/C(=O)OC)\F)/F