Tetrachlorobisphenol A is a chlorinated derivative of bisphenol A used primarily as a flame retardant monomer in the production of epoxy, polyester, and polycarbonate resins. Its structure contains four chlorine atoms and two hydroxyl groups, contributing to its flame-retardant properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 79-95-8
3,3'-Dimethylbisphenol A
Manufacture of plastics and resins
Bis(4-chlorobenzoic) anhydride
Chemical intermediate for organic synthesis
Sodium permanganate monohydrate
Oxidizing agent, chemical raw material
TRIPHENYLPHOSPHINE OXIDE
organophosphorus compound and reaction byproduct
2,6-dichloro-4-[2-(3,5-dichloro-4-hydroxyphenyl)propan-2-yl]phenol
KYPYTERUKNKOLP-UHFFFAOYSA-N
CC(C)(C1=CC(=C(C(=C1)Cl)O)Cl)C2=CC(=C(C(=C2)Cl)O)Cl