2-Naphthol-d8 is a deuterated research reagent used as a reference standard in analytical chemistry. Its isotopic labeling with deuterium allows for precise quantification and tracing in mass spectrometry and NMR spectroscopy.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 78832-61-8
(3-acetamidophenyl)boronic acid
research compound for organic synthesis
2-NITROPYRENE
research compound
Oxalyl chloride
chlorinating reagent in organic synthesis
Benzenesulfonamide, 5-amino-2-methyl-N-phenyl-
sulfonamide research compound
2-NAPHTHOL
dye and pigment intermediate
2-Naphthol-1,3,4,5,6,7,8-d7
Deuterated research reference standard
1,2,3,4,5,6,8-heptadeuterio-7-deuteriooxynaphthalene
JWAZRIHNYRIHIV-GZORGGLCSA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])O[2H])[2H])[2H])[2H]