Diethyl (3-fluoro-4-nitrophenyl)methylmalonate is a chemical compound bearing a methylmalonate diester framework substituted with a fluorinated nitroaryl group. It is primarily used as a synthetic intermediate in the preparation of various pharmaceutical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 78543-06-3
Diethyl (4-amino-3-fluorophenyl)methylmalonate
pharmaceutical intermediate
3-(TRIFLUOROMETHYL)BENZENEPROPANOL
Pharmaceutical intermediate
(S)-(-)-2-Amino-3-methyl-1,1-diphenyl-1-butanol
Chiral pharmaceutical intermediate
2-chloro-3-iodopyridine
pharmaceutical intermediate
diethyl 2-(3-fluoro-4-nitrophenyl)-2-methylpropanedioate
VHMVOAWAZZEEPH-UHFFFAOYSA-N
CCOC(=O)C(C)(C1=CC(=C(C=C1)[N+](=O)[O-])F)C(=O)OCC