2-(4-Fluorophenyl)indole is a chemical compound used primarily as a research reagent. It features an indole core substituted with a fluorophenyl group, contributing to its aromatic and halogen-containing structure.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 782-17-2
Clomipramine Impurity 11
nitrosamine impurity reference standard
3-bromo-4-fluorobenzyl bromide
organic synthesis building block
4-(Trifluoromethoxy)cinnamic acid
Research compound
D-erythro-Ritalinic Acid
research compound
DAPI dihydrochloride
fluorescent DNA staining reagent
2-(4-fluorophenyl)-1H-indole
VLHGDCJIDNVRFM-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C(N2)C3=CC=C(C=C3)F