(2S)-2-phenylpropanoic acid is a chiral carboxylic acid used primarily in co-crystallization studies. Its significance lies in its ability to form co-crystals with isonicotinamide, influencing melting-point behavior as investigated in crystallographic research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 7782-24-3
Iodic acid
Astringent and disinfectant
SELENIOUS ACID
Reagent for alkaloids and oxidizing agent
Molybdenum hexafluoride
Isotope separation reagent
(S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine
Research compound
(2R)-2-phenylpropanoic acid
chiral building block for pharmaceuticals
2-Phenylpropionic acid
Human xenobiotic metabolite research
(2S)-2-phenylpropanoic acid
YPGCWEMNNLXISK-ZETCQYMHSA-N
C[C@@H](C1=CC=CC=C1)C(=O)O