Boc-D-alanine is a protected amino acid derivative used as a building block in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino function and a free carboxylic acid, making it suitable for solid-phase or solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 7764-95-6
Boc-l-lys(ivdde)-oh
protected amino acid for peptide synthesis
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpentanoic acid
protected amino acid for peptide synthesis
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid
protected amino acid for peptide synthesis
N-alpha-t-Butyloxycarbonyl-N-alpha-methyl-L-isoleucine
protected amino acid for peptide synthesis
2,3-dichlorobenzoyl cyanide
Pharmaceutical intermediate
2-Chloro-5-nitrobenzotrifluoride
Pharmaceutical intermediate
3-BROMO-2-CHLORO-6-METHOXYPYRIDINE
pharmaceutical intermediate
Ethyl 2-(1H-indol-3-yl)acetate
pharmaceutical intermediate
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
QVHJQCGUWFKTSE-RXMQYKEDSA-N
C[C@H](C(=O)O)NC(=O)OC(C)(C)C