2-HYDROXY-5-NITROBENZYL BROMIDE is a chemical compound commonly used as a laboratory reagent. Its primary significance is in research applications for the chemical modification of tryptophan residues in proteins.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 772-33-8
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
3-Amino-3-(1-methyl-1H-pyrrol-2-yl)propanoic acid
research compound for peptide synthesis
1,3-Benzodioxole-5-carboxylic acid, 2,2-difluoro-, methyl ester
research compound
2-(bromomethyl)-4-nitrophenol
KFDPCYZHENQOBV-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])CBr)O