N-Benzylglycine hydrochloride is a research compound used in peptide synthesis. It is the hydrochloride salt form of N-benzylglycine, featuring both an amine and a carboxylic acid group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 7689-50-1
3-Amino-3-(1-methyl-1H-pyrrol-2-yl)propanoic acid
research compound for peptide synthesis
(R)-alpha-Propargylalanine
research compound for peptide synthesis
4-(Diethylamino)benzoic acid
research compound for peptide synthesis
Methyl 1-amino-1-cyclopentanecarboxylate, HCl
research compound for peptide synthesis
2-Fluoro-6-nitrotoluene
research compound
3-Cyano-4,6-dimethyl-2-hydroxypyridine
research compound
2,3,5,6-Tetrafluorophenol
research compound
Vinyl benzoate
human metabolite research compound
2-(benzylamino)acetic acid;hydrochloride
BUZJPENZWLUHJD-UHFFFAOYSA-N
C1=CC=C(C=C1)CNCC(=O)O.Cl