This compound is a pharmaceutical intermediate featuring a complex heterocyclic structure with trifluoromethyl and trifluorophenyl substituents. It is primarily used in the synthesis of active pharmaceutical ingredients.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 764667-65-4
(Z)-3-(Hydroxyimino)-1-(3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-4-(2,4,5-trifluorophenyl)butan-1-one
nitrosamine standard
(2S,3R)-3-acetamido-2-hydroxy-4-phenylbutanoic acid
peptide building block for synthesis
2-METHYL-1,3-CYCLOPENTANEDIONE
Synthetic building block for natural products
Methyl 3,3-diphenyloxirane-2-carboxylate
Intermediate for ambrisentan synthesis
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione
QAEDTLFWHIEVPK-UHFFFAOYSA-N
C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)CC(=O)CC3=CC(=C(C=C3F)F)F