(R)-(+)-Cathinone hydrochloride is a research reagent and the hydrochloride salt of the optically active (R)-enantiomer of cathinone, a naturally occurring alkaloid. It is primarily used in scientific research and analytical reference applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 76333-53-4
Methyl 2,2-dimethylpent-4-enoate
research compound
Antimony(V) chloride
Lewis acid catalyst and reagent
2-(Trimethylsilyl)ethoxymethyl chloride
Protecting reagent for hydroxyl groups
2-(mesitylamino)-9,10-dimethoxy-6,7-dihydro-4H-pyrimido[6,1-a]isoquinolin-4-one
research compound
2-amino-1-phenylpropan-1-one;hydrochloride
pharmaceutical reference standard
Cathinone hydrochloride
active pharmaceutical ingredient
(2R)-2-amino-1-phenylpropan-1-one;hydrochloride
HPZCAKYHISJOIK-OGFXRTJISA-N
C[C@H](C(=O)C1=CC=CC=C1)N.Cl