This compound is a phenolic compound featuring two methyl groups and a phenyl ring on a phenol core, giving it a moderately lipophilic and aromatic character. Its chemical structure includes two aromatic rings and one hydrogen-bond donor site, with a LogP of 3.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 76219-34-6
3,5-dimethyl-2-phenylphenol
GHQKKXMTRJXSQY-UHFFFAOYSA-N
CC1=CC(=C(C(=C1)O)C2=CC=CC=C2)C
—