Diethyl 2,3-difluorofumarate is a fluorinated organic compound used as a building block in chemical synthesis. It features two ester groups and two fluorine atoms on a carbon backbone, making it valuable for introducing fluorine into target molecules in research and industrial chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 7589-41-5
4-(Ethoxycarbonyl)-4,4-difluorobutanoic acid
fluorinated building block for synthesis
(2Z)-2,3-Difluoro-2-butenedioic acid
fluorinated building block for synthesis
Ethyl 2-fluoro-3-oxopentanoate
research compound
1-Ethyl-1-nitrosourea
experimental mutagen and ethylating agent
2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Vinyl boronate synthetic reagent
Phthalic Acid Anhydride-d4
Reference standard for analytical chemistry
Diethyl 2,3-difluoromaleate
research compound
diethyl (E)-2,3-difluorobut-2-enedioate
PBYMHUNMKVHXHO-AATRIKPKSA-N
CCOC(=O)/C(=C(/C(=O)OCC)\F)/F