Sudan I-d5 is a deuterated analytical reference standard, specifically a pentadeuterio-labeled derivative of Sudan I. It is primarily used as an internal standard in analytical chemistry for the quantification of Sudan I in various samples.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 752211-63-5
4-Ethynyl-N,N-dimethylaniline
research compound
Methyl L-phenylalaninate hydrochloride
Research reagent for peptide synthesis
Sodium 2-(4-(2-hydroxyethyl)piperazin-1-yl)ethanesulfonate
dipolar ionic buffer
H-alpha-Me-D-Phe(4-Br)-OH
research compound
C.I. Solvent Yellow 14
Dye for hydrocarbon solvents and oils
1-(2-METHOXY-D3-PHENYLAZO)-2-NAPHTHOL
Azo dye for coloration
Crocein Orange G
synthetic azo dye for coloring
E129
food color additive
1-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]naphthalen-2-ol
MRQIXHXHHPWVIL-RCQSQLKUSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N=NC2=C(C=CC3=CC=CC=C32)O)[2H])[2H]