Methyl L-leucinate hydrochloride is a chemical compound used as a pharmaceutical intermediate. It is the hydrochloride salt of the methyl ester of the amino acid L-leucine and is primarily employed in peptide synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 7517-19-3
(2R,4S)-ethyl 5-([1,1'-biphenyl]-4-yl)-4-aMino-2-Methylpentanoate
Pharmaceutical intermediate synthesis
(S)-tert-butyl 3-(3,4-Dihydroxyphenyl)-1-(dimethylamino)-1-oxopropan-2-ylcarbamate
peptide building block intermediate
4-chloro-2-fluorobenzeneacetonitrile
Pharmaceutical intermediate
5-Bromo-6-chloronicotinamide
pharmaceutical intermediate
methyl (2S)-2-amino-4-methylpentanoate;hydrochloride
DODCBMODXGJOKD-RGMNGODLSA-N
CC(C)C[C@@H](C(=O)OC)N.Cl