Quinoline-2-boronic acid is a boronic acid derivative of quinoline used primarily as a research reagent. Its structure features an aromatic heterocyclic ring system with a boronic acid functional group, making it a versatile building block in organic synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 745784-12-7
Ethyl cyclopropylideneacetate
research compound
Diethylene Glycol Bis(p-toluenesulfonate)
research compound for crystallography
1-(2-azidoethoxy)-2-(2-methoxyethoxy)ethane
PEG linker with azide group
(S)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID
Research compound
quinolin-2-ylboronic acid
DWHCQRBWSBKHMI-UHFFFAOYSA-N
B(C1=NC2=CC=CC=C2C=C1)(O)O