l-Alanine-d7 is an isotopically labeled form of the amino acid L-alanine, where seven hydrogen atoms are replaced by deuterium. It is primarily used as a research reagent in studies requiring a stable isotope-labeled internal standard, such as for analytical chemistry or metabolic tracing experiments.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 74280-71-0
Urethane-d5 (ethyl-d5)
isotopically labeled research compound
Nitrobenzene-(1)(3)C
isotopically labeled research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
1,3,5-Tribromobenzene-d3
isotopically labeled research compound
Triptophenolide
research compound
2'-Deoxyadenosine 5'-(disodium dihydrogen triphosphate)
Nucleotide triphosphate research reagent
1,2-O-Isopropylidene-sn-glycerol-d5
deuterated research reagent
2-bromo-4-methoxybenzoic acid
research compound
deuterio (2S)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate
QNAYBMKLOCPYGJ-VQIVFXRSSA-N
[2H][C@@](C(=O)O[2H])(C([2H])([2H])[2H])N([2H])[2H]