Di(succinimido) carbonate is a research reagent used as a coupling agent in peptide synthesis. Its structure consists of two succinimidyl groups linked by a carbonate moiety, which facilitates the formation of amide bonds under mild conditions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 74124-79-1
(Dimethylamino)((2,5-dioxopyrrolidin-1-yl)oxy)-N,N-dimethylmethaniminium hexafluorophosphate
coupling reagent for peptide synthesis
Philips CD-i
coupling reagent for peptide synthesis
AMP-PCP (disodium)
research compound
ADA sodium salt
biological buffer reagent
Guanosine-5'-diphosphate disodium salt
nucleoside diphosphate research reagent
2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol
Certified reference standard
bis(2,5-dioxopyrrolidin-1-yl) carbonate
PFYXSUNOLOJMDX-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O