This compound is a protected glutamic acid derivative featuring a tert-butyloxycarbonyl (Boc) protecting group and cyclohexyl ester moieties. It is primarily used as a pharmaceutical intermediate in peptide synthesis, particularly for the introduction of glutamic acid residues with orthogonal protection.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 73821-97-3
Boc-Asp(OcHx)-OH
protected amino acid for peptide synthesis
Acotiamide Impurity 36
pharmaceutical impurity reference standard
1,15-diethyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate
pharmaceutical intermediate
5-(2-bromoacetyl)-2-hydroxybenzamide
Pharmaceutical intermediate
(4R)-5-(tert-butoxy)-4-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
peptide synthesis intermediate
Boc-D-Glu(Ochex)-Oh
Protected amino acid for peptide synthesis
(2S)-5-cyclohexyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
FDNMLANBNJDIRG-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC1CCCCC1)C(=O)O