This compound is an Fmoc-protected amino acid derivative, specifically this compound. It is used as a research reagent in peptide synthesis, where the Fmoc group serves as a temporary protecting group for the amino function.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 737007-45-3
Fmoc-D-Trp-OH
research compound for peptide synthesis
Fmoc-L-tryptophan
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-[(triphenylmethyl)carbamoyl]butanoic acid
Fmoc-protected amino acid derivative
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(R)-Nomega-(t-Butoxycarbonyl)-Nalpha-(9-fluorenylmethoxycarbonyl)-alpha-methylornithin
Fmoc-protected amino acid derivative
(S)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-5-amino-5-oxopentanoic acid
Fmoc-protected amino acid derivative
5-(3-Aminophenyl)tetrazole
research compound
Rhodium(II) perfluorobutyrate dimer
Research reagent for organic synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
SEWQKWXKJVYKOO-QFIPXVFZSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C=CC=N5)C(=O)O