X-Gal (5-bromo-4-chloro-3-indolyl beta-D-galactoside) is a chromogenic compound used as a substrate for the enzyme beta-galactosidase. Upon enzymatic cleavage, it produces an intensely blue product, enabling visual detection of enzyme activity in laboratory and research settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 7240-90-6
4-Dibenzothiophenamine
research compound
1-(2-Chloroethyl)pyrrolidine hydrochloride
research compound
5-Bromo-1H-indole-2-carboxylic acid
research compound
1-Isobutyl-4-piperidone
research compound
(2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
OPIFSICVWOWJMJ-AEOCFKNESA-N
C1=CC(=C(C2=C1NC=C2O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)Cl)Br