This compound is an Fmoc-protected amino acid reagent used in solid-phase peptide synthesis. It features a fluorenylmethyloxycarbonyl (Fmoc) protecting group and tert-butyl ether side-chain protection, making it suitable for the stepwise assembly of peptides.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 71989-35-0
(2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid
Peptide building block
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-phenylpropanoic acid
Fmoc-protected amino acid reagent
6-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanoic acid
Fmoc-protected amino acid reagent
METHYL (2S,3R)-2-AMINO-3-(TERT-BUTOXY)BUTANOATE HYDROCHLORIDE
protected amino acid building block
(2R)-6-oxopiperidine-2-carboxylic acid
research compound
DdATP trisodium
Nucleotide analog research reagent
6-[5-(2-OXO-HEXAHYDRO-THIENO[3,4-D]IMIDAZOL-4-YL)-PENTANOYLAMINO]-HEXANOIC ACID
biotinylation reagent for protein labeling
(2R,3S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
Peptide synthesis building block
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid
LZOLWEQBVPVDPR-UHFFFAOYSA-N
CC(C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C