Chloramphenicol base is a chemical compound used as a pharmaceutical intermediate in the manufacturing of the antibiotic chloramphenicol. It contains both alcohol and amine functional groups and is characterized by an aromatic ring and polar substituents.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 716-61-0
Di-p-toluoyl-D-tartaric acid monohydrate
chiral resolution reagent
(2R,3R)-2,3-Bis((4-methylbenzoyl)oxy)succinic acid hydrate
chiral resolving agent intermediate
4-Amino-5-(ethylthio)-2-methoxybenzoic acid
Pharmaceutical intermediate for amisulpride impurities
4-amino-2-methoxy-5-(methylthio)benzoic acid
Pharmaceutical intermediate for amisulpride impurities
(1R,2R)-2-amino-1-(4-nitrophenyl)propane-1,3-diol
OCYJXSUPZMNXEN-RKDXNWHRSA-N
C1=CC(=CC=C1[C@H]([C@@H](CO)N)O)[N+](=O)[O-]